
CAS 1251196-26-5
:2-(2,3-Dichlorophenyl)morpholine
Description:
2-(2,3-Dichlorophenyl)morpholine is an organic compound characterized by its morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom. The presence of the 2,3-dichlorophenyl group indicates that two chlorine atoms are substituted on a phenyl ring at the second and third positions, contributing to the compound's unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on its specific structure and substituents. It may possess biological activity, making it of interest in pharmaceutical research, particularly in the development of agrochemicals or medicinal compounds. The dichlorophenyl moiety can enhance the lipophilicity of the molecule, potentially influencing its interaction with biological targets. Safety and handling precautions are essential, as compounds with halogenated groups can exhibit toxicity or environmental persistence. Overall, 2-(2,3-Dichlorophenyl)morpholine is a compound of interest in various chemical and biological applications, warranting further investigation into its properties and potential uses.
Formula:C10H11Cl2NO
InChI:InChI=1S/C10H11Cl2NO/c11-8-3-1-2-7(10(8)12)9-6-13-4-5-14-9/h1-3,9,13H,4-6H2
InChI key:InChIKey=IXEKUZIPYFNWLS-UHFFFAOYSA-N
SMILES:ClC1=C(C=CC=C1Cl)C2CNCCO2
Synonyms:- Morpholine, 2-(2,3-dichlorophenyl)-
- 2-(2,3-Dichlorophenyl)morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.