CymitQuimica logo

CAS 1251196-28-7

:

2-(3,4,5-Trifluorophenyl)morpholine

Description:
2-(3,4,5-Trifluorophenyl)morpholine is a chemical compound characterized by its morpholine structure, which is a six-membered ring containing both nitrogen and oxygen atoms. The presence of a trifluorophenyl group indicates that three fluorine atoms are substituted on a phenyl ring at the 3, 4, and 5 positions, contributing to the compound's unique electronic and steric properties. This substitution can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. The morpholine moiety provides basic properties, making the compound potentially useful in medicinal chemistry, particularly in the development of pharmaceuticals. The trifluoromethyl groups can also impart significant effects on the compound's solubility and stability. Additionally, the compound's molecular structure suggests potential applications in agrochemicals or as a building block in organic synthesis. Safety and handling considerations should be taken into account, as fluorinated compounds can exhibit distinct environmental and health impacts. Overall, 2-(3,4,5-Trifluorophenyl)morpholine is a versatile compound with interesting chemical properties and potential applications in various fields.
Formula:C10H10F3NO
InChI:InChI=1S/C10H10F3NO/c11-7-3-6(4-8(12)10(7)13)9-5-14-1-2-15-9/h3-4,9,14H,1-2,5H2
InChI key:InChIKey=GKVMTXHFCLJZNK-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(F)C1F)C2CNCCO2
Synonyms:
  • 2-(3,4,5-Trifluorophenyl)morpholine
  • Morpholine, 2-(3,4,5-trifluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.