CAS 125153-61-9
:5-(1-cyano-4-((2-(5-fluoro-2-methoxyphenoxy)ethyl)amino)-1-isopropylbutyl)-2-methoxybenzenesulfonamide
Description:
The chemical substance known as 5-(1-cyano-4-((2-(5-fluoro-2-methoxyphenoxy)ethyl)amino)-1-isopropylbutyl)-2-methoxybenzenesulfonamide, with the CAS number 125153-61-9, is a complex organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features multiple functional groups, including a cyano group and methoxy groups, contributing to its potential biological activity. The presence of a fluorine atom in the structure may enhance lipophilicity and influence the compound's pharmacokinetic properties. Additionally, the compound's intricate structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its stability, solubility, and reactivity would be critical factors in determining its utility in research or therapeutic contexts. Overall, this compound exemplifies the complexity often found in drug design, where multiple substituents can significantly affect biological interactions and efficacy.
Formula:C24H32FN3O5S
InChI:InChI=1/C24H32FN3O5S/c1-17(2)24(16-26,18-6-8-21(32-4)23(14-18)34(27,29)30)10-5-11-28-12-13-33-22-15-19(25)7-9-20(22)31-3/h6-9,14-15,17,28H,5,10-13H2,1-4H3,(H2,27,29,30)
SMILES:CC(C)C(CCCNCCOc1cc(ccc1OC)F)(C#N)c1ccc(c(c1)S(=O)(=O)N)OC
Synonyms:- 5-Cfmbs
- Benzenesulfonamide, 5-(1-cyano-4-((2-(5-fluoro-2-methoxyphenoxy)ethyl)amino)-1-(1-methylethyl)butyl)-2-methoxy-
- 5-(3-Cyano-6-{[2-(5-Fluoro-2-Methoxyphenoxy)Ethyl]Amino}-2-Methylhexan-3-Yl)-2-Methoxybenzenesulfonamide
- 5-(1-Cyano-4-((2-(5-fluoro-2-methoxyphenoxy)ethyl)amino)-1-isopropylbutyl)-2-methoxybenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenesulfonamide, 5-[1-cyano-4-[[2-(5-fluoro-2-methoxyphenoxy)ethyl]amino]-1-(1-methylethyl)butyl]-2-methoxy-
CAS:Formula:C24H32FN3O5SMolecular weight:493.5914
