CAS 1251537-34-4
:B-(1-Acetyl-1,2,3,6-tetrahydro-4-pyridinyl)boronic acid
Description:
B-(1-Acetyl-1,2,3,6-tetrahydro-4-pyridinyl)boronic acid is a boronic acid derivative characterized by its unique structure, which includes a boron atom bonded to a pyridine ring that is further substituted with an acetyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the tetrahydropyridine moiety contributes to its potential biological activity, as such structures are often found in pharmacologically active compounds. Additionally, the acetyl group may enhance lipophilicity and influence the compound's reactivity. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, B-(1-Acetyl-1,2,3,6-tetrahydro-4-pyridinyl)boronic acid represents a versatile building block in chemical research, particularly in the development of new therapeutic agents and materials.
Formula:C7H12BNO3
InChI:InChI=1S/C7H12BNO3/c1-6(10)9-4-2-7(3-5-9)8(11)12/h2,11-12H,3-5H2,1H3
InChI key:InChIKey=UZTQRIAEVDHZBR-UHFFFAOYSA-N
SMILES:B(O)(O)C=1CCN(C(C)=O)CC1
Synonyms:- B-(1-Acetyl-1,2,3,6-tetrahydro-4-pyridinyl)boronic acid
- (1-Acetyl-1,2,3,6-tetrahydropyridin-4-yl)boronic acid
- Boronic acid, B-(1-acetyl-1,2,3,6-tetrahydro-4-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boronic acid, B-(1-acetyl-1,2,3,6-tetrahydro-4-pyridinyl)-
CAS:Formula:C7H12BNO3Purity:%Molecular weight:168.9861
