CAS 125159-92-4
:bromo-[2-(3-methoxyphenyl)ethyl]magnesium
Description:
Bromo-[2-(3-methoxyphenyl)ethyl]magnesium, with the CAS number 125159-92-4, is an organomagnesium compound, specifically a Grignard reagent. This compound features a bromo group attached to a 2-(3-methoxyphenyl)ethyl moiety, which contributes to its reactivity and utility in organic synthesis. Grignard reagents are known for their strong nucleophilic properties, allowing them to react with a variety of electrophiles, including carbonyl compounds, to form alcohols. The presence of the methoxy group enhances the electron density on the aromatic ring, potentially influencing the reactivity and selectivity of the compound in synthetic applications. Bromo-[2-(3-methoxyphenyl)ethyl]magnesium is typically handled under anhydrous conditions due to its sensitivity to moisture, which can lead to hydrolysis and the formation of unwanted byproducts. As with other Grignard reagents, it is crucial to use appropriate safety measures when working with this compound, as it can be highly reactive and flammable.
Formula:C9H11BrMgO
InChI:InChI=1/C9H11O.BrH.Mg/c1-3-8-5-4-6-9(7-8)10-2;;/h4-7H,1,3H2,2H3;1H;/q;;+1/p-1/rC9H11BrMgO/c1-12-9-4-2-3-8(7-9)5-6-11-10/h2-4,7H,5-6H2,1H3
SMILES:[CH2]Cc1cccc(c1)OC.Br.[Mg]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.