CAS 125162-81-4

6-Amino-2-hydroxymethylhexan-1-ol

Description:

6-Amino-2-hydroxymethylhexan-1-ol, with the CAS number 125162-81-4, is an organic compound characterized by the presence of an amino group and a hydroxymethyl group attached to a hexane backbone. This compound typically exhibits properties associated with both amines and alcohols, such as being polar and capable of forming hydrogen bonds, which can influence its solubility in water and other solvents. The amino group contributes to its basicity, while the hydroxymethyl group can participate in various chemical reactions, including those involving nucleophilic substitution. This compound may be utilized in various applications, including pharmaceuticals, where it could serve as an intermediate in the synthesis of more complex molecules. Its structural features suggest potential reactivity in organic synthesis, particularly in the formation of amides or other derivatives. Safety and handling considerations should be observed, as with any chemical substance, to mitigate risks associated with exposure or reactivity.

Formula: C₇H₁₇NO₂

InChI: InChI=1/C7H17NO2/c8-4-2-1-3-7(5-9)6-10/h7,9-10H,1-6,8H2

SMILES: C(CCN)CC(CO)CO

Synonyms:

• 2-(4-Aminobutyl)-1,3-Propanediol
• 2-(4-Aminobutyl)Propane-1,3-Diol

1,3-Propanediol, 2-(4-aminobutyl)-

CAS: 125162-81-4

Formula: C₇H₁₇NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 147.2154

Ref: IN-DA000NA1

6-Amino-2-hydroxymethyl Hexan-1-ol

Controlled Product

CAS: 125162-81-4

Stability Hygroscopic
Applications 6-Amino-2-hydroxymethyl Hexan-1-ol (cas# 125162-81-4) is a compound useful in organic synthesis.
References Rubina, A., et al.: Anal. Biochem., 325, 92 (2004),

Formula: C₇H₁₇NO₂

Color and Shape: Neat

Molecular weight: 147.22

Ref: TR-A611235

2-(4-Aminobutyl)propane-1,3-diol

CAS: 125162-81-4

Purity: 95%

Molecular weight: 147.2180023

Ref: 10-F620643