CAS 1251716-89-8

2-[(6-Chloro-2-methyl-4-pyrimidinyl)amino]-5-thiazolecarboxylic acid

Description:

2-[(6-Chloro-2-methyl-4-pyrimidinyl)amino]-5-thiazolecarboxylic acid, with the CAS number 1251716-89-8, is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a thiazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of nitrogen and sulfur atoms in its structure. The chloro and methyl substituents on the pyrimidine ring can influence its reactivity and solubility, making it of interest in medicinal chemistry. The carboxylic acid functional group contributes to its acidity and can participate in various chemical reactions, including esterification and amidation. This compound may also exhibit specific interactions with biological targets, which could be relevant in drug development or agricultural applications. Overall, its unique combination of functional groups and heterocycles suggests potential utility in various chemical and pharmaceutical contexts.

Formula: C₉H₇ClN₄O₂S

InChI: InChI=1S/C9H7ClN4O2S/c1-4-12-6(10)2-7(13-4)14-9-11-3-5(17-9)8(15)16/h2-3H,1H3,(H,15,16)(H,11,12,13,14)

InChI key: InChIKey=LEPDNDFKYFKQNP-UHFFFAOYSA-N

SMILES: N(C=1SC(C(O)=O)=CN1)C=2C=C(Cl)N=C(C)N2

Synonyms:

• 5-Thiazolecarboxylic acid, 2-[(6-chloro-2-methyl-4-pyrimidinyl)amino]-
• 2-[(6-Chloro-2-methyl-4-pyrimidinyl)amino]-5-thiazolecarboxylic acid

2-((6-Chloro-2-methylpyrimidin-4-yl)amino)thiazole-5-carboxylic acid

CAS: 1251716-89-8

Formula: C₉H₇ClN₄O₂S

Purity: 95%

Molecular weight: 270.6955

Ref: IN-DA000NAM