CAS 1251736-87-4

5-[1-(2-Chlorophenyl)-2-methoxy-2-oxoethyl]-6,7-dihydrothieno[3,2-c]pyridinium

Description:

5-[1-(2-Chlorophenyl)-2-methoxy-2-oxoethyl]-6,7-dihydrothieno[3,2-c]pyridinium is a chemical compound characterized by its unique structural features, which include a thieno[3,2-c]pyridinium core and a substituted phenyl group. The presence of a chlorophenyl moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The methoxy and keto functional groups contribute to its reactivity and solubility properties, which can influence its biological activity. This compound may exhibit interesting pharmacological properties due to its complex structure, potentially interacting with various biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Additionally, the compound's stability, solubility, and reactivity would be important factors to consider in its application, particularly in drug formulation and delivery systems. Overall, this compound represents a class of heterocyclic compounds that may have significant implications in drug discovery and development.

Formula: C₁₆H₁₅ClNO₂S

InChI: InChI=1S/C16H15ClNO2S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14/h2-5,7,9-10,15H,6,8H2,1H3/q+1

InChI key: InChIKey=MGLOAEFTRZPJLT-UHFFFAOYSA-N

SMILES: C(C(OC)=O)([N+]1=CC2=C(CC1)SC=C2)C3=C(Cl)C=CC=C3

Synonyms:

• 5-[1-(2-Chlorophenyl)-2-methoxy-2-oxoethyl]-6,7-dihydrothieno[3,2-c]pyridinium
• Thieno[3,2-c]pyridinium, 5-[1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-6,7-dihydro-

5-[1-(2-Chlorophenyl)-2-methoxy-2-oxoethyl]-6,7-dihydrothieno[3,2-c]pyridiniumBromide (~90%)

Controlled Product

CAS: 1251736-87-4

Stability Hygroscopic
Applications One of the unknown impurities generated during the accelerated stability storage of Clopidogrel bisulfate tablets. Clopidogrel impurity.
References Gomez, Y., et al.: J. Pharm. Biomed. Anal., 34, 341 (2004), Ksycinska, H., et al.: J. Pharm. Biomed. Anal., 41, 533 (2006),

Formula: C₁₆H₁₅ClNO₂S·Br

Purity: ~90%

Color and Shape: Neat

Molecular weight: 400.72

Ref: TR-C378365