CAS 1251751-05-9
:(3S)-3-(Cyclopropylmethyl)morpholine
Description:
(3S)-3-(Cyclopropylmethyl)morpholine is a chemical compound characterized by its morpholine backbone, which is a six-membered ring containing both nitrogen and oxygen atoms. The specific stereochemistry indicated by (3S) refers to the configuration at the third carbon of the morpholine ring, suggesting that it has a specific spatial arrangement that can influence its biological activity and interactions. The cyclopropylmethyl group attached to the nitrogen atom contributes to the compound's unique properties, potentially affecting its solubility, reactivity, and pharmacological profile. Morpholine derivatives are often studied for their applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The presence of the cyclopropyl group may enhance the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. Overall, (3S)-3-(Cyclopropylmethyl)morpholine is a compound with potential utility in various chemical and biological contexts, warranting further investigation into its properties and applications.
Formula:C8H15NO
InChI:InChI=1S/C8H15NO/c1-2-7(1)5-8-6-10-4-3-9-8/h7-9H,1-6H2/t8-/m0/s1
InChI key:InChIKey=PMRUVUSSJRXOGM-QMMMGPOBSA-N
SMILES:C([C@H]1COCCN1)C2CC2
Synonyms:- (3S)-3-(Cyclopropylmethyl)morpholine
- Morpholine, 3-(cyclopropylmethyl)-, (3S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
