CAS 1251760-96-9

1,4,5,6-Tetrahydro-1-methyl-3-cyclopentapyrazolemethanol

Description:

1,4,5,6-Tetrahydro-1-methyl-3-cyclopentapyrazolemethanol is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazole ring fused to a cyclopentane moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in various organic solvents. The presence of the hydroxymethyl group contributes to its reactivity and may influence its interactions in biological systems. Its molecular structure suggests it may participate in hydrogen bonding, which can affect its physical properties, such as melting and boiling points. Additionally, the methyl group on the pyrazole ring may enhance lipophilicity, impacting its pharmacokinetic properties if considered for medicinal applications. The compound's specific applications and behavior in chemical reactions would depend on its functional groups and overall molecular conformation. As with many heterocycles, it may also exhibit interesting electrochemical properties, making it a candidate for further research in fields such as medicinal chemistry and materials science.

Formula: C₈H₁₂N₂O

InChI: InChI=1S/C8H12N2O/c1-10-8-4-2-3-6(8)7(5-11)9-10/h11H,2-5H2,1H3

InChI key: InChIKey=GXTQDTXWYDZHAP-UHFFFAOYSA-N

SMILES: C(O)C=1C2=C(N(C)N1)CCC2

Synonyms:

• 3-Cyclopentapyrazolemethanol, 1,4,5,6-tetrahydro-1-methyl-
• 1,4,5,6-Tetrahydro-1-methyl-3-cyclopentapyrazolemethanol