CAS 1251762-21-6

Pyrrolo[1,2-a]pyrazine-1-methanol

Description:

Pyrrolo[1,2-a]pyrazine-1-methanol is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyrazine moiety. This compound features a methanol group attached to the pyrazine ring, influencing its chemical reactivity and solubility properties. Typically, compounds of this class exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The presence of nitrogen atoms in the rings contributes to its potential as a ligand in coordination chemistry and may also affect its electronic properties. Pyrrolo[1,2-a]pyrazine-1-methanol is likely to be soluble in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. Its synthesis may involve multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, with potential applications in various fields.

Formula: C₈H₈N₂O

InChI: InChI=1S/C8H8N2O/c11-6-7-8-2-1-4-10(8)5-3-9-7/h1-5,11H,6H2

InChI key: InChIKey=SQMUSQJRSXDTCG-UHFFFAOYSA-N

SMILES: C(O)C=1C=2N(C=CC2)C=CN1

Synonyms:

• Pyrrolo[1,2-a]pyrazine-1-methanol