
CAS 1251834-03-3
:3-Iodo-1-methyl-1H-indole-7-carboxaldehyde
Description:
3-Iodo-1-methyl-1H-indole-7-carboxaldehyde is a chemical compound that belongs to the indole family, characterized by its fused bicyclic structure containing a benzene ring and a pyrrole ring. The presence of an aldehyde functional group (-CHO) at the 7-position and an iodine atom at the 3-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research. The iodine substituent can enhance the compound's lipophilicity and influence its interaction with biological targets. Additionally, the methyl group at the 1-position can affect the electronic properties of the indole ring, potentially impacting its reactivity and stability. As with many indole derivatives, 3-Iodo-1-methyl-1H-indole-7-carboxaldehyde may serve as a precursor for further chemical modifications, leading to the development of novel compounds with desired pharmacological properties.
Formula:C10H8INO
InChI:InChI=1S/C10H8INO/c1-12-5-9(11)8-4-2-3-7(6-13)10(8)12/h2-6H,1H3
InChI key:InChIKey=FXFGGWVKJSSQLZ-UHFFFAOYSA-N
SMILES:C(=O)C1=C2C(C(I)=CN2C)=CC=C1
Synonyms:- 3-Iodo-1-methyl-1H-indole-7-carboxaldehyde
- 1H-Indole-7-carboxaldehyde, 3-iodo-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
