
CAS 1251904-27-4
:(αS)-2-Amino-α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-5-thiazolepropanoic acid
Description:
(αS)-2-Amino-α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-5-thiazolepropanoic acid, identified by its CAS number 1251904-27-4, is a synthetic amino acid derivative characterized by its unique structural features. This compound contains a thiazole ring, which contributes to its biological activity and potential as a building block in peptide synthesis. The presence of the fluorenylmethoxycarbonyl (Fmoc) group indicates that it is likely used in solid-phase peptide synthesis as a protective group for the amino functionality, facilitating the assembly of peptides while preventing unwanted reactions. The α-amino acid structure suggests that it can participate in typical amino acid reactions, including peptide bond formation. Its stereochemistry, denoted by the (αS) configuration, implies specific spatial arrangements that can influence its interaction with biological targets. Overall, this compound is of interest in medicinal chemistry and biochemistry for its potential applications in drug development and peptide synthesis.
Formula:C21H19N3O4S
InChI:InChI=1S/C21H19N3O4S/c22-20-23-10-12(29-20)9-18(19(25)26)24-21(27)28-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,10,17-18H,9,11H2,(H2,22,23)(H,24,27)(H,25,26)/t18-/m0/s1
InChI key:InChIKey=QNEFEEJKZPBSRE-SFHVURJKSA-N
SMILES:C(OC(N[C@@H](CC=1SC(N)=NC1)C(O)=O)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:- 5-Thiazolepropanoic acid, 2-amino-α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (αS)-
- (αS)-2-Amino-α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-5-thiazolepropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.