CAS 1251922-53-8

3-[4-(Acetyloxy)butyl]-2,4-thiazolidinedione

Description:

3-[4-(Acetyloxy)butyl]-2,4-thiazolidinedione is a synthetic organic compound characterized by its thiazolidinedione core, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features an acetyloxy group attached to a butyl chain, contributing to its potential biological activity. Thiazolidinediones are known for their role in pharmacology, particularly in the treatment of diabetes, as they can enhance insulin sensitivity. The presence of the acetyloxy group may influence the compound's solubility and reactivity, potentially affecting its pharmacokinetics and pharmacodynamics. The molecular structure suggests that it may exhibit interactions with various biological targets, making it of interest in medicinal chemistry. Additionally, the compound's CAS number, 1251922-53-8, allows for precise identification and retrieval of information in chemical databases. Overall, this compound exemplifies the intersection of organic synthesis and medicinal application, warranting further investigation into its therapeutic potential and mechanisms of action.

Formula: C₉H₁₃NO₄S

InChI: InChI=1S/C9H13NO4S/c1-7(11)14-5-3-2-4-10-8(12)6-15-9(10)13/h2-6H2,1H3

InChI key: InChIKey=QJYQNXLXCKTRBT-UHFFFAOYSA-N

SMILES: C(CCCOC(C)=O)N1C(=O)CSC1=O

Synonyms:

• 3-[4-(Acetyloxy)butyl]-2,4-thiazolidinedione
• 2,4-Thiazolidinedione, 3-[4-(acetyloxy)butyl]-

4-(2,4-Dioxo-1,3-thiazolidin-3-yl)butyl acetate

CAS: 1251922-53-8

Versatile small molecule scaffold

Formula: C₉H₁₃NO₄S

Purity: Min. 95%

Molecular weight: 231.27 g/mol

Ref: 3D-BAC92253