CAS 1251922-59-4

Acetamide, N-(3,5-difluorophenyl)-2-(methylamino)-, hydrochloride (1:1)

Description:

Acetamide, N-(3,5-difluorophenyl)-2-(methylamino)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This substance features a difluorophenyl moiety, indicating the presence of two fluorine atoms on a phenyl ring, which can significantly influence its chemical reactivity and biological activity. The methylamino group suggests that it has potential interactions with biological systems, possibly affecting neurotransmitter pathways. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 1251922-59-4, allows for precise identification in chemical databases. Safety and handling considerations are essential, as with many amides and halogenated compounds, due to potential toxicity and environmental impact. Overall, this compound's unique structure suggests potential applications in drug development and research.

Formula: C₉H₁₀F₂N₂O·ClH

InChI: InChI=1S/C9H10F2N2O.ClH/c1-12-5-9(14)13-8-3-6(10)2-7(11)4-8;/h2-4,12H,5H2,1H3,(H,13,14);1H

InChI key: InChIKey=WZCITUBVMIIFIF-UHFFFAOYSA-N

SMILES: N(C(CNC)=O)C1=CC(F)=CC(F)=C1.Cl

Synonyms:

• Acetamide, N-(3,5-difluorophenyl)-2-(methylamino)-, hydrochloride (1:1)

N-(3,5-Difluorophenyl)-2-(methylamino)acetamide hydrochloride

CAS: 1251922-59-4

Versatile small molecule scaffold

Formula: C₉H₁₁ClF₂N₂O

Purity: Min. 95%

Molecular weight: 236.64 g/mol

Ref: 3D-BAC92259