CAS 1251922-67-4

2(1H)-Pyrimidinethione, 5-(trifluoromethyl)-, sodium salt (1:1)

Description:

2(1H)-Pyrimidinethione, 5-(trifluoromethyl)-, sodium salt (1:1) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of a trifluoromethyl group enhances its reactivity and lipophilicity, making it of interest in various chemical applications. As a sodium salt, it exhibits ionic properties, which can influence its solubility in polar solvents, particularly water. This compound may be utilized in pharmaceutical research, agrochemicals, or as a reagent in organic synthesis due to its potential biological activity and ability to participate in nucleophilic reactions. The thione functional group contributes to its chemical behavior, potentially allowing for coordination with metal ions or participation in redox reactions. Overall, the unique combination of the pyrimidine structure, trifluoromethyl substitution, and sodium salt formation provides a versatile platform for further exploration in chemical and biological contexts.

Formula: C₅H₃F₃N₂S·Na

InChI: InChI=1S/C5H3F3N2S.Na/c6-5(7,8)3-1-9-4(11)10-2-3;/h1-2H,(H,9,10,11);

InChI key: InChIKey=RFXCHNUBIGXOGU-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CNC(=S)N=C1.[Na]

Synonyms:

• 2(1H)-Pyrimidinethione, 5-(trifluoromethyl)-, sodium salt (1:1)