CAS 1251922-84-5

Propanamide, 2-amino-N-[4-(2H-1,2,3-triazol-2-yl)phenyl]-, hydrochloride (1:1)

Description:

Propanamide, 2-amino-N-[4-(2H-1,2,3-triazol-2-yl)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and the presence of a triazole moiety, which contributes to its potential biological activity. The compound features a propanamide backbone with an amino group and a phenyl ring substituted with a 2H-1,2,3-triazole, indicating its potential for interactions in biological systems, possibly as a pharmaceutical agent. The hydrochloride salt form enhances its solubility in water, making it more suitable for various applications, including medicinal chemistry. The presence of the triazole ring suggests potential antifungal or antimicrobial properties, as triazoles are known for their role in drug development. Additionally, the compound's structure may allow for hydrogen bonding and other interactions, influencing its reactivity and stability. Overall, this compound's unique structural features position it as a candidate for further research in drug discovery and development.

Formula: C₁₁H₁₃N₅O·ClH

InChI: InChI=1S/C11H13N5O.ClH/c1-8(12)11(17)15-9-2-4-10(5-3-9)16-13-6-7-14-16;/h2-8H,12H2,1H3,(H,15,17);1H

InChI key: InChIKey=SUWHZCIZSKFFRQ-UHFFFAOYSA-N

SMILES: N(C(C(C)N)=O)C1=CC=C(C=C1)N2N=CC=N2.Cl

Synonyms:

• Propanamide, 2-amino-N-[4-(2H-1,2,3-triazol-2-yl)phenyl]-, hydrochloride (1:1)