CAS 1251922-88-9

1H-Pyrazolo[3,4-b]pyridine-5-propanoic acid, 2,3,6,7-tetrahydro-4-methyl-3,6-dioxo-, hydrochloride (1:1)

Description:

1H-Pyrazolo[3,4-b]pyridine-5-propanoic acid, 2,3,6,7-tetrahydro-4-methyl-3,6-dioxo-, hydrochloride (1:1) is a chemical compound characterized by its complex bicyclic structure, which includes a pyrazolo and pyridine moiety. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of a carboxylic acid group and a hydrochloride salt form. It is likely to be soluble in polar solvents, such as water, due to the ionic nature of the hydrochloride. The presence of multiple functional groups, including dioxo and methyl substituents, suggests potential reactivity and biological activity, making it of interest in medicinal chemistry. Its molecular structure may contribute to specific interactions with biological targets, which could be explored for therapeutic applications. As with many compounds in this class, safety and handling precautions should be observed, given the potential for biological activity and the need for proper characterization in research settings.

Formula: C₁₀H₁₁N₃O₄·ClH

InChI: InChI=1S/C10H11N3O4.ClH/c1-4-5(2-3-6(14)15)9(16)11-8-7(4)10(17)13-12-8;/h2-3H2,1H3,(H,14,15)(H3,11,12,13,16,17);1H

InChI key: InChIKey=TWDBAJYQZUYMRP-UHFFFAOYSA-N

SMILES: CC=1C2=C(NC(=O)C1CCC(O)=O)NNC2=O.Cl

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-5-propanoic acid, 2,3,6,7-tetrahydro-4-methyl-3,6-dioxo-, hydrochloride (1:1)

3-{4-Methyl-3,6-dioxo-1H,2H,3H,6H,7H-pyrazolo[3,4-b]pyridin-5-yl}propanoic acid hydrochloride

CAS: 1251922-88-9

Versatile small molecule scaffold

Formula: C₁₀H₁₂ClN₃O₄

Purity: Min. 95%

Molecular weight: 273.67 g/mol

Ref: 3D-BAC92288