
CAS 1251923-00-8
:5-(Trifluoromethyl)-2-azabicyclo[2.2.1]heptan-5-ol
Description:
5-(Trifluoromethyl)-2-azabicyclo[2.2.1]heptan-5-ol is a bicyclic organic compound characterized by its unique bicyclic structure, which includes a nitrogen atom integrated into the ring system. The presence of a trifluoromethyl group (-CF3) significantly influences its chemical properties, imparting high lipophilicity and potential biological activity. The hydroxyl group (-OH) at the 5-position contributes to its polarity and can participate in hydrogen bonding, affecting solubility and reactivity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Additionally, the trifluoromethyl group can enhance metabolic stability and alter the compound's interaction with biological targets. Overall, the combination of its bicyclic framework, functional groups, and fluorinated substituents makes 5-(Trifluoromethyl)-2-azabicyclo[2.2.1]heptan-5-ol a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C7H10F3NO
InChI:InChI=1S/C7H10F3NO/c8-7(9,10)6(12)2-5-1-4(6)3-11-5/h4-5,11-12H,1-3H2
InChI key:InChIKey=YBZLZXFQVWKHSS-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1(O)C2CC(C1)NC2
Synonyms:- 5-(Trifluoromethyl)-2-azabicyclo[2.2.1]heptan-5-ol
- 2-Azabicyclo[2.2.1]heptan-5-ol, 5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.