CAS 1251923-02-0

4-Piperidinamine, N-(4-methyl-2-thiazolyl)-, hydrochloride (1:2)

Description:

4-Piperidinamine, N-(4-methyl-2-thiazolyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and thiazole functional groups. This substance typically appears as a hydrochloride salt, which enhances its solubility in water, making it suitable for various applications in pharmaceutical and biochemical research. The presence of the thiazole ring contributes to its potential biological activity, as thiazoles are often found in biologically active compounds. The piperidine moiety is known for its role in enhancing the pharmacological properties of drugs, including its ability to interact with various receptors. The compound's hydrochloride form indicates that it is a protonated species, which can influence its stability and reactivity. Overall, this compound may exhibit properties such as moderate to high polarity, potential basicity due to the piperidine nitrogen, and the ability to form hydrogen bonds, which are critical for its interactions in biological systems. Further studies would be necessary to elucidate its specific applications and mechanisms of action.

Formula: C₉H₁₅N₃S·2ClH

InChI: InChI=1S/C9H15N3S.2ClH/c1-7-6-13-9(11-7)12-8-2-4-10-5-3-8;;/h6,8,10H,2-5H2,1H3,(H,11,12);2*1H

InChI key: InChIKey=JIZAZJGDPPUYAG-UHFFFAOYSA-N

SMILES: N(C=1SC=C(C)N1)C2CCNCC2.Cl

Synonyms:

• 4-Piperidinamine, N-(4-methyl-2-thiazolyl)-, hydrochloride (1:2)

N-(4-Methyl-1,3-thiazol-2-yl)piperidin-4-amine dihydrochloride

CAS: 1251923-02-0

Versatile small molecule scaffold

Formula: C₉H₁₇Cl₂N₃S

Purity: Min. 95%

Molecular weight: 270.22 g/mol

Ref: 3D-BAC92302