CAS 1251923-06-4

Pyridine, 3-(bromomethyl)-2-chloro-5-nitro-

Description:

Pyridine, 3-(bromomethyl)-2-chloro-5-nitro- is a heterocyclic organic compound characterized by a pyridine ring substituted with a bromomethyl group, a chlorine atom, and a nitro group. The presence of these substituents significantly influences its chemical properties and reactivity. The bromomethyl group can act as a reactive site for further chemical modifications, while the nitro group is known for its electron-withdrawing properties, which can enhance the acidity of nearby hydrogen atoms. The chlorine atom also contributes to the compound's reactivity and can participate in nucleophilic substitution reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as solubility and boiling point, are influenced by the functional groups present, making it important to consider these factors in practical applications. Safety precautions should be taken when handling this compound due to the potential hazards associated with its halogenated and nitro substituents.

Formula: C₆H₄BrClN₂O₂

InChI: InChI=1S/C6H4BrClN2O2/c7-2-4-1-5(10(11)12)3-9-6(4)8/h1,3H,2H2

InChI key: InChIKey=ASQYIXLIIATUMQ-UHFFFAOYSA-N

SMILES: C(Br)C=1C=C(N(=O)=O)C=NC1Cl

Synonyms:

• 3-(Bromomethyl)-2-chloro-5-nitropyridine
• Pyridine, 3-(bromomethyl)-2-chloro-5-nitro-