CAS 1251923-15-5

1-(2,2,2-Trifluoroethyl)-1H-imidazole-2-acetonitrile

Description:

1-(2,2,2-Trifluoroethyl)-1H-imidazole-2-acetonitrile is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of the trifluoroethyl group introduces significant electronegativity and lipophilicity, influencing the compound's reactivity and solubility. The acetonitrile functional group contributes to its polar nature, making it potentially useful in various chemical reactions and applications, including as a building block in pharmaceuticals or agrochemicals. This compound may exhibit unique properties such as enhanced stability and specific interactions with biological targets due to the trifluoromethyl substituent. Its CAS number, 1251923-15-5, allows for precise identification and retrieval of information regarding its safety, handling, and regulatory status. As with many fluorinated compounds, it may possess distinct characteristics such as increased resistance to metabolic degradation, which can be advantageous in drug design. However, the environmental impact and toxicity of fluorinated compounds should also be considered in their application and development.

Formula: C₇H₆F₃N₃

InChI: InChI=1S/C7H6F3N3/c8-7(9,10)5-13-4-3-12-6(13)1-2-11/h3-4H,1,5H2

InChI key: InChIKey=WWHCIFNAXSSZJE-UHFFFAOYSA-N

SMILES: C(C#N)C=1N(CC(F)(F)F)C=CN1

Synonyms:

• 1-(2,2,2-Trifluoroethyl)-1H-imidazole-2-acetonitrile
• 2-[1-(2,2,2-Trifluoroethyl)-1H-imidazol-2-yl]acetonitrile
• 1H-Imidazole-2-acetonitrile, 1-(2,2,2-trifluoroethyl)-

2-[1-(2,2,2-Trifluoroethyl)-1H-imidazol-2-yl]acetonitrile

CAS: 1251923-15-5

Versatile small molecule scaffold

Formula: C₇H₆F₃N₃

Purity: Min. 95%

Molecular weight: 189.14 g/mol

Ref: 3D-BAC92315