CymitQuimica logo

CAS 1251923-24-6

:

8-Amino-3-(phenylmethyl)-3-azabicyclo[3.2.1]octane-8-carboxylic acid

Description:
8-Amino-3-(phenylmethyl)-3-azabicyclo[3.2.1]octane-8-carboxylic acid is a bicyclic compound characterized by its unique structural features, which include a bicyclo[3.2.1]octane framework, an amino group, and a carboxylic acid functional group. The presence of the phenylmethyl substituent contributes to its aromatic properties and may influence its biological activity. This compound is of interest in medicinal chemistry due to its potential interactions with biological targets, particularly in the context of neuropharmacology. The amino and carboxylic acid groups suggest that it can participate in hydrogen bonding, which may enhance its solubility and reactivity in biological systems. Additionally, the bicyclic structure may confer rigidity, potentially affecting its conformational dynamics and interactions with receptors or enzymes. Overall, 8-Amino-3-(phenylmethyl)-3-azabicyclo[3.2.1]octane-8-carboxylic acid represents a complex molecule with potential applications in drug development and research into its pharmacological properties.
Formula:C15H20N2O2
InChI:InChI=1S/C15H20N2O2/c16-15(14(18)19)12-6-7-13(15)10-17(9-12)8-11-4-2-1-3-5-11/h1-5,12-13H,6-10,16H2,(H,18,19)
InChI key:InChIKey=YQPJIBYKNDUIBN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(N)C2CN(CC3=CC=CC=C3)CC1CC2
Synonyms:
  • 3-Azabicyclo[3.2.1]octane-8-carboxylic acid, 8-amino-3-(phenylmethyl)-
  • 8-Amino-3-(phenylmethyl)-3-azabicyclo[3.2.1]octane-8-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.