CAS 1251923-27-9

Propanamide, 2-amino-N-[6-(1-piperidinyl)-3-pyridinyl]-, hydrochloride (1:2)

Description:

Propanamide, 2-amino-N-[6-(1-piperidinyl)-3-pyridinyl]-, hydrochloride (1:2) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a pharmaceutical agent. The presence of a piperidine ring and a pyridine moiety suggests that this compound may exhibit significant biological activity, possibly interacting with various receptors or enzymes in the body. As a hydrochloride salt, it is likely to be more soluble in water, enhancing its bioavailability. The compound's structure implies it may have applications in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions, given the piperidine and pyridine components often associated with such therapeutic areas. Additionally, the presence of amino and amide groups may contribute to its ability to form hydrogen bonds, influencing its pharmacokinetic properties. Overall, this compound's unique structural features position it as a candidate for further research in drug development and therapeutic applications.

Formula: C₁₃H₂₀N₄O·2ClH

InChI: InChI=1S/C13H20N4O.2ClH/c1-10(14)13(18)16-11-5-6-12(15-9-11)17-7-3-2-4-8-17;;/h5-6,9-10H,2-4,7-8,14H2,1H3,(H,16,18);2*1H

InChI key: InChIKey=MHWOTYWVUKEAGQ-UHFFFAOYSA-N

SMILES: N(C(C(C)N)=O)C1=CC=C(N=C1)N2CCCCC2.Cl

Synonyms:

• Propanamide, 2-amino-N-[6-(1-piperidinyl)-3-pyridinyl]-, hydrochloride (1:2)

2-Amino-N-[6-(piperidin-1-yl)pyridin-3-yl]propanamide dihydrochloride

CAS: 1251923-27-9

Versatile small molecule scaffold

Formula: C₁₃H₂₂Cl₂N₄O

Purity: Min. 95%

Molecular weight: 321.2 g/mol

Ref: 3D-BAC92327