CAS 1251923-40-6

Benzonitrile, 4-[[(2-methoxyethyl)amino]methyl]-, hydrochloride (1:1)

Description:

Benzonitrile, 4-[[(2-methoxyethyl)amino]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzonitrile moiety and a 2-methoxyethyl amino group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications. It is likely to exhibit properties typical of amines and nitriles, such as basicity due to the amino group and potential reactivity associated with the nitrile functional group. The presence of the methoxyethyl group may influence its polarity and solubility characteristics. This compound may be of interest in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and reactivity. As with any chemical, proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is essential for confirming its identity and purity in laboratory settings.

Formula: C₁₁H₁₄N₂O·ClH

InChI: InChI=1S/C11H14N2O.ClH/c1-14-7-6-13-9-11-4-2-10(8-12)3-5-11;/h2-5,13H,6-7,9H2,1H3;1H

InChI key: InChIKey=LFGYKTSBISCQTR-UHFFFAOYSA-N

SMILES: C(NCCOC)C1=CC=C(C#N)C=C1.Cl

Synonyms:

• Benzonitrile, 4-[[(2-methoxyethyl)amino]methyl]-, hydrochloride (1:1)

4-{[(2-Methoxyethyl)amino]methyl}benzonitrile hydrochloride

CAS: 1251923-40-6

Versatile small molecule scaffold

Formula: C₁₁H₁₅ClN₂O

Purity: Min. 95%

Molecular weight: 226.7 g/mol

Ref: 3D-BAC92340