CAS 1251923-41-7

Benzamide, 3-(aminomethyl)-N-(1,1-dimethylethyl)-, hydrochloride (1:1)

Description:

Benzamide, 3-(aminomethyl)-N-(1,1-dimethylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from benzoic acid. The presence of an aminomethyl group indicates that it has an amino (-NH2) functional group attached to a methylene (-CH2-) bridge, enhancing its reactivity and potential for forming hydrogen bonds. The N-(1,1-dimethylethyl) substituent suggests that the compound has a bulky tert-butyl group, which can influence its steric properties and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it easier to handle in various applications. This compound may exhibit biological activity, potentially serving as a pharmaceutical intermediate or a research chemical. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is used. Safety data should be consulted for handling and storage guidelines, as with any chemical substance.

Formula: C₁₂H₁₈N₂O·ClH

InChI: InChI=1S/C12H18N2O.ClH/c1-12(2,3)14-11(15)10-6-4-5-9(7-10)8-13;/h4-7H,8,13H2,1-3H3,(H,14,15);1H

InChI key: InChIKey=LXXFYJLICCXMPI-UHFFFAOYSA-N

SMILES: C(NC(C)(C)C)(=O)C1=CC(CN)=CC=C1.Cl

Synonyms:

• Benzamide, 3-(aminomethyl)-N-(1,1-dimethylethyl)-, hydrochloride (1:1)

3-(Aminomethyl)-N-tert-butylbenzamide hydrochloride

CAS: 1251923-41-7

Versatile small molecule scaffold

Formula: C₁₂H₁₉ClN₂O

Purity: Min. 95%

Molecular weight: 242.74 g/mol

Ref: 3D-BAC92341