CAS 1251923-49-5

2,2-Bis(trifluoromethyl)cyclopropanamine

Description:

2,2-Bis(trifluoromethyl)cyclopropanamine is a chemical compound characterized by its unique cyclopropane structure, which is substituted with two trifluoromethyl groups and an amine functional group. The presence of the trifluoromethyl groups significantly influences its chemical properties, imparting high electronegativity and lipophilicity, which can enhance its reactivity and solubility in organic solvents. This compound is likely to exhibit interesting biological activity due to the presence of the amine group, which can participate in hydrogen bonding and interact with various biological targets. Additionally, the trifluoromethyl groups can stabilize the molecule and affect its steric properties, potentially influencing its conformational dynamics. As a relatively specialized compound, it may find applications in pharmaceuticals, agrochemicals, or materials science, particularly in the development of fluorinated compounds that exhibit unique physical and chemical properties. Safety and handling considerations are important due to the presence of fluorinated groups, which can pose environmental and health risks.

Formula: C₅H₅F₆N

InChI: InChI=1S/C5H5F6N/c6-4(7,8)3(1-2(3)12)5(9,10)11/h2H,1,12H2

InChI key: InChIKey=PEDXOWDTDDLCQV-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1(C(F)(F)F)C(N)C1

Synonyms:

• Cyclopropanamine, 2,2-bis(trifluoromethyl)-
• 2,2-Bis(trifluoromethyl)cyclopropanamine

2,2-Bis(trifluoromethyl)cyclopropan-1-amine

Controlled Product

CAS: 1251923-49-5

Formula: C₅H₅F₆N

Color and Shape: Neat

Molecular weight: 193.09

Ref: TR-B588635