CAS 1251923-59-7

4H-1,2,4-Triazole, 3-(chloromethyl)-5-cyclopropyl-4-methyl-, hydrochloride (1:1)

Description:

4H-1,2,4-Triazole, 3-(chloromethyl)-5-cyclopropyl-4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This specific derivative features a chloromethyl group and a cyclopropyl substituent, contributing to its unique reactivity and potential biological activity. The hydrochloride form indicates that the compound is a salt, which can enhance its solubility in water and stability. Typically, triazoles are known for their applications in pharmaceuticals, particularly as antifungal agents, and may exhibit various biological activities due to their ability to interact with biological targets. The presence of the cyclopropyl group may influence the compound's pharmacokinetics and pharmacodynamics. Additionally, the chloromethyl group can serve as a reactive site for further chemical modifications. Overall, this compound's characteristics suggest potential utility in medicinal chemistry, although specific applications would depend on further research into its biological properties and mechanisms of action.

Formula: C₇H₁₀ClN₃·ClH

InChI: InChI=1S/C7H10ClN3.ClH/c1-11-6(4-8)9-10-7(11)5-2-3-5;/h5H,2-4H2,1H3;1H

InChI key: InChIKey=DEUOKWTVVPIMBR-UHFFFAOYSA-N

SMILES: CN1C(=NN=C1CCl)C2CC2.Cl

Synonyms:

• 4H-1,2,4-Triazole, 3-(chloromethyl)-5-cyclopropyl-4-methyl-, hydrochloride (1:1)

3-(Chloromethyl)-5-cyclopropyl-4-methyl-4H-1,2,4-triazole hydrochloride

CAS: 1251923-59-7

Versatile small molecule scaffold

Formula: C₇H₁₁Cl₂N₃

Purity: Min. 95%

Molecular weight: 208.09 g/mol

Ref: 3D-BAC92359