CAS 1251923-65-5

1,2,4-Oxadiazole-5-methanamine, 3-cyclopropyl-α-(1-methylethyl)-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-5-methanamine, 3-cyclopropyl-α-(1-methylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which contributes to its heterocyclic nature and potential biological activity. The presence of the methanamine group suggests it may exhibit basic properties, while the cyclopropyl and isopropyl substituents can influence its steric and electronic characteristics, potentially affecting its reactivity and interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The compound may be of interest in medicinal chemistry due to its structural features that could lead to various pharmacological effects. However, specific data regarding its toxicity, stability, and detailed biological activity would require further investigation through experimental studies. Overall, this compound exemplifies the complexity and diversity of heterocyclic compounds in chemical research and drug development.

Formula: C₉H₁₅N₃O·ClH

InChI: InChI=1S/C9H15N3O.ClH/c1-5(2)7(10)9-11-8(12-13-9)6-3-4-6;/h5-7H,3-4,10H2,1-2H3;1H

InChI key: InChIKey=FGKLAPVZQLMLAG-UHFFFAOYSA-N

SMILES: C(C(C)C)(N)C1=NC(=NO1)C2CC2.Cl

Synonyms:

• 1,2,4-Oxadiazole-5-methanamine, 3-cyclopropyl-α-(1-methylethyl)-, hydrochloride (1:1)

1-(3-Cyclopropyl-1,2,4-oxadiazol-5-yl)-2-methylpropan-1-amine hydrochloride

CAS: 1251923-65-5

Versatile small molecule scaffold

Formula: C₉H₁₆ClN₃O

Purity: Min. 95%

Molecular weight: 217.69 g/mol

Ref: 3D-BAC92365