CAS 1251923-69-9

1,2,3,4-Tetrahydro-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonyl chloride

Description:

1,2,3,4-Tetrahydro-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonyl chloride is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a sulfonyl chloride functional group, which is known for its reactivity, particularly in nucleophilic substitution reactions. The presence of the dioxo groups contributes to its potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals. The tetrahydro configuration indicates that the compound is saturated, which may influence its solubility and reactivity. Additionally, the methyl group attached to the nitrogen atom can affect the compound's electronic properties and steric hindrance. Overall, this compound is of interest in medicinal chemistry and may exhibit biological activity, although specific applications and biological properties would require further investigation. As with many sulfonyl chlorides, it should be handled with care due to its potential reactivity and the release of hydrochloric acid upon hydrolysis.

Formula: C₈H₆ClN₃O₄S

InChI: InChI=1S/C8H6ClN3O4S/c1-12-6-5(7(13)11-8(12)14)2-4(3-10-6)17(9,15)16/h2-3H,1H3,(H,11,13,14)

InChI key: InChIKey=FHJPNZYMEGEHKE-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC(S(Cl)(=O)=O)=CN2)C(=O)NC1=O

Synonyms:

• Pyrido[2,3-d]pyrimidine-6-sulfonyl chloride, 1,2,3,4-tetrahydro-1-methyl-2,4-dioxo-
• 1,2,3,4-Tetrahydro-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonyl chloride
• 1-Methyl-2,4-dioxo-1H,2H,3H,4H-pyrido[2,3-d]pyrimidine-6-sulfonyl chloride

1-Methyl-2,4-dioxo-1H,2H,3H,4H-pyrido[2,3-d]pyrimidine-6-sulfonyl chloride

CAS: 1251923-69-9

Versatile small molecule scaffold

Formula: C₈H₆ClN₃O₄S

Purity: Min. 95%

Molecular weight: 275.67 g/mol

Ref: 3D-BAC92369