CymitQuimica logo

CAS 1251923-77-9

:

Bicyclo[4.1.0]heptan-2-amine, 7,7-difluoro-

Description:
Bicyclo[4.1.0]heptan-2-amine, 7,7-difluoro- is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a seven-membered ring system with a nitrogen atom incorporated into the framework. The presence of two fluorine atoms at the 7-position significantly influences its chemical properties, including increased electronegativity and potential reactivity. This compound features an amine functional group, which can participate in hydrogen bonding, making it potentially useful in various chemical reactions and applications. The bicyclic structure contributes to its rigidity, which can affect its conformational behavior and interactions with other molecules. Additionally, the compound's specific stereochemistry and functional groups may impart unique biological activity, making it of interest in medicinal chemistry and drug design. Overall, Bicyclo[4.1.0]heptan-2-amine, 7,7-difluoro- is a compound with distinctive structural and chemical characteristics that could be explored for various applications in organic synthesis and pharmaceuticals.
Formula:C7H11F2N
InChI:InChI=1S/C7H11F2N/c8-7(9)4-2-1-3-5(10)6(4)7/h4-6H,1-3,10H2
InChI key:InChIKey=KMCWIAYQAMMYGR-UHFFFAOYSA-N
SMILES:FC1(F)C2C1CCCC2N
Synonyms:
  • Bicyclo[4.1.0]heptan-2-amine, 7,7-difluoro-
  • 7,7-Difluorobicyclo[4.1.0]heptan-2-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.