
CAS 1251923-85-9
:2,3,4,5-Tetrahydro-1H-thieno[3,2-e]-1,4-diazepine
Description:
2,3,4,5-Tetrahydro-1H-thieno[3,2-e]-1,4-diazepine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a thieno ring fused with a diazepine. This compound features a saturated framework, contributing to its stability and potential reactivity. The presence of nitrogen atoms in the diazepine ring imparts basic properties, making it capable of participating in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The thieno moiety adds to its aromatic character, which can influence its electronic properties and interactions with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and stability in different solvents can vary, affecting its application in various fields. Overall, 2,3,4,5-Tetrahydro-1H-thieno[3,2-e]-1,4-diazepine represents a versatile structure with potential implications in pharmacology and material science.
Formula:C7H10N2S
InChI:InChI=1S/C7H10N2S/c1-4-10-7-5-8-2-3-9-6(1)7/h1,4,8-9H,2-3,5H2
InChI key:InChIKey=XHVSEUAVFGBJMH-UHFFFAOYSA-N
SMILES:C12=C(SC=C1)CNCCN2
Synonyms:- 2,3,4,5-Tetrahydro-1H-thieno[3,2-e]-1,4-diazepine
- 1H-Thieno[3,2-e]-1,4-diazepine, 2,3,4,5-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.