CAS 1251923-88-2

1,4-Benzoxathiin-2-carboxylic acid, 2,3-dihydro-, 4,4-dioxide

Description:

1,4-Benzoxathiin-2-carboxylic acid, 2,3-dihydro-, 4,4-dioxide, identified by CAS number 1251923-88-2, is a heterocyclic organic compound featuring a benzoxathiin core structure. This compound is characterized by the presence of a sulfur atom within a six-membered ring, which contributes to its unique chemical properties. The "4,4-dioxide" designation indicates the presence of two carbonyl (C=O) groups at the 4-position of the ring, enhancing its reactivity and potential for forming various derivatives. The carboxylic acid functional group at the 2-position provides acidic properties, allowing for potential interactions in biological systems or chemical reactions. This compound may exhibit interesting pharmacological activities due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, its solubility and stability can vary based on the surrounding environment, influencing its applications in research and industry. Overall, 1,4-benzoxathiin derivatives are recognized for their diverse chemical behavior and potential utility in various fields, including pharmaceuticals and agrochemicals.

Formula: C₉H₈O₅S

InChI: InChI=1S/C9H8O5S/c10-9(11)7-5-15(12,13)8-4-2-1-3-6(8)14-7/h1-4,7H,5H2,(H,10,11)

InChI key: InChIKey=USKKYHJQMOAEOD-UHFFFAOYSA-N

SMILES: O=S1(=O)C=2C(OC(C(O)=O)C1)=CC=CC2

Synonyms:

• 1,4-Benzoxathiin-2-carboxylic acid, 2,3-dihydro-, 4,4-dioxide

2,3-Dihydrobenzo[b][1,4]oxathiine-2-carboxylic acid 4,4-dioxide

CAS: 1251923-88-2

Versatile small molecule scaffold

Formula: C₉H₈O₅S

Purity: Min. 95%

Molecular weight: 228.22 g/mol

Ref: 3D-BAC92388