CAS 1251923-96-2

1-Propanesulfonamide, N-3-pyrrolidinyl-, hydrochloride (1:1)

Description:

1-Propanesulfonamide, N-3-pyrrolidinyl-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of the pyrrolidine moiety suggests that it may exhibit unique pharmacological activities, potentially influencing its interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. This compound may be utilized in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Its structure indicates potential for hydrogen bonding and other intermolecular interactions, which can affect its stability and reactivity. Additionally, the sulfonamide group may confer properties such as increased acidity and the ability to form complexes with metal ions. Overall, this compound's characteristics make it a subject of interest in both synthetic and medicinal chemistry, warranting further investigation into its potential applications and mechanisms of action.

Formula: C₇H₁₆N₂O₂S·ClH

InChI: InChI=1S/C7H16N2O2S.ClH/c1-2-5-12(10,11)9-7-3-4-8-6-7;/h7-9H,2-6H2,1H3;1H

InChI key: InChIKey=QIQSUQJZMACKPG-UHFFFAOYSA-N

SMILES: N(S(CCC)(=O)=O)C1CCNC1.Cl

Synonyms:

• 1-Propanesulfonamide, N-3-pyrrolidinyl-, hydrochloride (1:1)

N-(Pyrrolidin-3-yl)propane-1-sulfonamide hydrochloride

CAS: 1251923-96-2

Versatile small molecule scaffold

Formula: C₇H₁₇ClN₂O₂S

Purity: Min. 95%

Molecular weight: 228.74 g/mol

Ref: 3D-BAC92396