
CAS 1251923-97-3
:1-Methyl-1H-pyrazole-4-butanethioamide
Description:
1-Methyl-1H-pyrazole-4-butanethioamide is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a methyl group and a butanethioamide functional group. This compound typically exhibits properties associated with both pyrazole derivatives and thioamides, such as potential biological activity and reactivity due to the presence of the thioamide functional group, which can participate in various chemical reactions. The pyrazole moiety is known for its role in medicinal chemistry, often contributing to the pharmacological properties of compounds. Additionally, the presence of the butanethioamide group may enhance solubility and influence the compound's interaction with biological targets. The compound's molecular weight, melting point, and solubility characteristics would depend on its specific structural features and functional groups. Overall, 1-Methyl-1H-pyrazole-4-butanethioamide represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C8H13N3S
InChI:InChI=1S/C8H13N3S/c1-11-6-7(5-10-11)3-2-4-8(9)12/h5-6H,2-4H2,1H3,(H2,9,12)
InChI key:InChIKey=MLKDBCIRLDGLID-UHFFFAOYSA-N
SMILES:C(CCC(N)=S)C=1C=NN(C)C1
Synonyms:- 1H-Pyrazole-4-butanethioamide, 1-methyl-
- 1-Methyl-1H-pyrazole-4-butanethioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.