
CAS 1251924-00-1
:3-Azabicyclo[3.3.1]nonane-1-carboxylic acid
Description:
3-Azabicyclo[3.3.1]nonane-1-carboxylic acid is a bicyclic compound characterized by its unique structure, which includes a nitrogen atom incorporated into a bicyclic framework. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The bicyclic structure provides rigidity and can influence the compound's interactions with biological systems, making it of interest in medicinal chemistry and drug design. The presence of the nitrogen atom may also impart basic properties, allowing for potential interactions with various biological targets. Additionally, the compound's stereochemistry can affect its pharmacological properties, including binding affinity and selectivity. As a relatively specialized compound, it may not be widely encountered outside of specific research contexts, particularly in studies related to neurochemistry or the development of novel therapeutic agents. Overall, 3-Azabicyclo[3.3.1]nonane-1-carboxylic acid exemplifies the complexity and diversity of bicyclic compounds in organic chemistry.
Formula:C9H15NO2
InChI:InChI=1S/C9H15NO2/c11-8(12)9-3-1-2-7(4-9)5-10-6-9/h7,10H,1-6H2,(H,11,12)
InChI key:InChIKey=JRTABUQUPPIJJN-UHFFFAOYSA-N
SMILES:C(O)(=O)C12CC(CNC1)CCC2
Synonyms:- 3-Azabicyclo[3.3.1]nonane-1-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.