
CAS 1251924-08-9
:6-(Trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-ol
Description:
6-(Trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-ol is a bicyclic organic compound characterized by its unique bicyclic structure, which includes a nitrogen atom in the ring system, making it a bicyclic amine. The presence of a trifluoromethyl group (-CF3) significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. The hydroxyl group (-OH) at the 6-position contributes to its polarity and can participate in hydrogen bonding, which may influence solubility in various solvents. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its specific interactions with biological targets can be influenced by the trifluoromethyl group, which can modulate electronic properties and steric effects. Overall, 6-(Trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-ol represents a complex structure with potential applications in drug development and materials science.
Formula:C7H10F3NO
InChI:InChI=1S/C7H10F3NO/c8-7(9,10)6(12)2-4-1-5(6)11-3-4/h4-5,11-12H,1-3H2
InChI key:InChIKey=KDUZYHDGQUZWSS-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1(O)C2CC(C1)CN2
Synonyms:- 2-Azabicyclo[2.2.1]heptan-6-ol, 6-(trifluoromethyl)-
- 6-(Trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.