
CAS 1251924-15-8
:3-Amino-1-(trifluoromethyl)cyclopentanol
Description:
3-Amino-1-(trifluoromethyl)cyclopentanol is an organic compound characterized by the presence of an amino group and a trifluoromethyl group attached to a cyclopentanol ring. The amino group (-NH2) contributes to its basicity and potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The trifluoromethyl group (-CF3) is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. This compound is likely to exhibit polar characteristics due to the hydroxyl (-OH) group, which can engage in hydrogen bonding, affecting its solubility in polar solvents. The cyclopentanol structure provides a cyclic framework that can impart unique steric and electronic properties. Overall, 3-Amino-1-(trifluoromethyl)cyclopentanol may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research into its reactivity and biological activity.
Formula:C6H10F3NO
InChI:InChI=1S/C6H10F3NO/c7-6(8,9)5(11)2-1-4(10)3-5/h4,11H,1-3,10H2
InChI key:InChIKey=AYCCOAABGNCNAQ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1(O)CC(N)CC1
Synonyms:- 3-Amino-1-(trifluoromethyl)cyclopentan-1-ol
- Cyclopentanol, 3-amino-1-(trifluoromethyl)-
- 3-Amino-1-(trifluoromethyl)cyclopentanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.