CAS 1251924-20-5

1,1-Dimethylethyl N-[1-[(hydroxyamino)iminomethyl]cyclobutyl]carbamate

Description:

1,1-Dimethylethyl N-[1-[(hydroxyamino)iminomethyl]cyclobutyl]carbamate, identified by its CAS number 1251924-20-5, is a chemical compound that features a complex structure characterized by the presence of a carbamate functional group. This compound includes a cyclobutyl moiety, which contributes to its cyclic structure, and a hydroxyamino group that introduces potential reactivity and hydrogen bonding capabilities. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, which can influence its solubility and interaction with biological systems. The compound may exhibit properties typical of carbamates, such as potential biological activity, including herbicidal or pesticidal effects, depending on its specific application. Its unique structural features suggest that it could participate in various chemical reactions, making it of interest in fields such as medicinal chemistry and agrochemicals. However, detailed studies would be necessary to fully elucidate its properties, reactivity, and potential applications.

Formula: C₁₀H₁₉N₃O₃

InChI: InChI=1S/C10H19N3O3/c1-9(2,3)16-8(14)12-10(5-4-6-10)7(11)13-15/h15H,4-6H2,1-3H3,(H2,11,13)(H,12,14)

InChI key: InChIKey=NJCTYVNAPFQCMS-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1(C(NO)=N)CCC1

Synonyms:

• [1-(N-Hydroxycarbamimidoyl)-cyclobutyl]-carbamic acid tert-butyl ester
• Carbamic acid, N-[1-[(hydroxyamino)iminomethyl]cyclobutyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[1-[(hydroxyamino)iminomethyl]cyclobutyl]carbamate

tert-Butyl N-[1-(N-hydroxycarbamimidoyl)cyclobutyl]carbamate

CAS: 1251924-20-5

Versatile small molecule scaffold

Formula: C₁₀H₁₉N₃O₃

Purity: Min. 95%

Molecular weight: 229.28 g/mol

Ref: 3D-BAC92420