CAS 1251924-21-6

Thieno[3,2-c]pyridine-4-carboxylic acid, 4,5,6,7-tetrahydro-, hydrochloride (1:1)

Description:

Thieno[3,2-c]pyridine-4-carboxylic acid, 4,5,6,7-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure that incorporates both a thieno and pyridine moiety. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential reactivity in various chemical reactions. The tetrahydro configuration indicates that the compound contains a saturated ring system, enhancing its stability and solubility in polar solvents. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it suitable for pharmaceutical applications. The presence of the hydrochloride indicates that it can form ionic interactions, which may influence its biological activity and pharmacokinetics. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific applications and interactions would depend on further studies and characterization, including its behavior in biological systems and potential therapeutic uses.

Formula: C₈H₉NO₂S·ClH

InChI: InChI=1S/C8H9NO2S.ClH/c10-8(11)7-5-2-4-12-6(5)1-3-9-7;/h2,4,7,9H,1,3H2,(H,10,11);1H

InChI key: InChIKey=GBOQCHMSTBMOPF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C2=C(SC=C2)CCN1.Cl

Synonyms:

• Thieno[3,2-c]pyridine-4-carboxylic acid, 4,5,6,7-tetrahydro-, hydrochloride (1:1)

4H,5H,6H,7H-Thieno[3,2-c]pyridine-4-carboxylic acid hydrochloride

CAS: 1251924-21-6

Versatile small molecule scaffold

Formula: C₈H₁₀ClNO₂S

Purity: Min. 95%

Molecular weight: 219.69 g/mol

Ref: 3D-BAC92421