CAS 1251924-25-0

N-Methyl-1-(2,2,2-trifluoroethyl)-1H-imidazole-2-methanamine

Description:

N-Methyl-1-(2,2,2-trifluoroethyl)-1H-imidazole-2-methanamine is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a trifluoroethyl group, contributing to its unique properties, such as increased lipophilicity and potential biological activity. The presence of the N-methyl and methanamine functional groups suggests that it may exhibit basic characteristics, making it soluble in polar solvents. The trifluoromethyl group can enhance the compound's stability and influence its reactivity, potentially affecting its interactions with biological targets. This compound may be of interest in medicinal chemistry and pharmaceutical research due to its structural features, which could lead to novel therapeutic agents. Additionally, the trifluoromethyl group is known for its ability to modulate the pharmacokinetic properties of compounds, making it a valuable moiety in drug design. Overall, N-Methyl-1-(2,2,2-trifluoroethyl)-1H-imidazole-2-methanamine presents a unique combination of structural elements that may confer interesting chemical and biological properties.

Formula: C₇H₁₀F₃N₃

InChI: InChI=1S/C7H10F3N3/c1-11-4-6-12-2-3-13(6)5-7(8,9)10/h2-3,11H,4-5H2,1H3

InChI key: InChIKey=DQNBASDQZGWYSI-UHFFFAOYSA-N

SMILES: C(NC)C=1N(CC(F)(F)F)C=CN1

Synonyms:

• 1H-Imidazole-2-methanamine, N-methyl-1-(2,2,2-trifluoroethyl)-
• N-Methyl-1-(2,2,2-trifluoroethyl)-1H-imidazole-2-methanamine

Methyl({[1-(2,2,2-trifluoroethyl)-1H-imidazol-2-yl]methyl})amine

CAS: 1251924-25-0

Versatile small molecule scaffold

Formula: C₇H₁₀F₃N₃

Purity: Min. 95%

Molecular weight: 193.17 g/mol

Ref: 3D-BAC92425