
CAS 1251924-34-1
:2,2,2-Trifluoroethyl N-[6-(methylsulfonyl)-3-pyridinyl]carbamate
Description:
2,2,2-Trifluoroethyl N-[6-(methylsulfonyl)-3-pyridinyl]carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a pyridine moiety substituted with a methylsulfonyl group. This compound is typically classified as a carbamate, indicating the presence of a carbamate functional group (-NHCOO-). The trifluoroethyl group imparts significant lipophilicity and can influence the compound's biological activity and solubility. The methylsulfonyl group enhances the compound's potential for interactions with biological targets, making it of interest in pharmaceutical applications. The presence of the pyridine ring contributes to the compound's aromatic character and can affect its electronic properties. Overall, this compound may exhibit specific pharmacological activities, making it a subject of interest in medicinal chemistry and agrochemical research. Its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other chemical species.
Formula:C9H9F3N2O4S
InChI:InChI=1S/C9H9F3N2O4S/c1-19(16,17)7-3-2-6(4-13-7)14-8(15)18-5-9(10,11)12/h2-4H,5H2,1H3,(H,14,15)
InChI key:InChIKey=CTMKOVIEDZCQEJ-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=CC=C(NC(OCC(F)(F)F)=O)C=N1
Synonyms:- Carbamic acid, N-[6-(methylsulfonyl)-3-pyridinyl]-, 2,2,2-trifluoroethyl ester
- 2,2,2-Trifluoroethyl N-[6-(methylsulfonyl)-3-pyridinyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.