CAS 1251924-46-5

2-Thiazoleacetic acid, 4-(trifluoromethyl)-, sodium salt (1:1)

Description:

2-Thiazoleacetic acid, 4-(trifluoromethyl)-, sodium salt (1:1) is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity and potential applications in pharmaceuticals. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its interaction with biological targets. As a sodium salt, it is typically more soluble in water compared to its acid form, which can facilitate its use in various formulations. This compound may exhibit properties such as antimicrobial or anti-inflammatory activities, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with enzymes or receptors, which can be explored in drug development. Additionally, the compound's stability and reactivity can be influenced by the presence of the sodium ion and the trifluoromethyl group, affecting its behavior in different chemical environments. Overall, 2-Thiazoleacetic acid, 4-(trifluoromethyl)-, sodium salt (1:1) represents a versatile compound with potential applications in various fields, including agriculture and pharmaceuticals.

Formula: C₆H₄F₃NO₂S·Na

InChI: InChI=1S/C6H4F3NO2S.Na/c7-6(8,9)3-2-13-4(10-3)1-5(11)12;/h2H,1H2,(H,11,12);

InChI key: InChIKey=BFTZFIDSKFTJQE-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N=C(CC(O)=O)SC1.[Na]

Synonyms:

• 2-Thiazoleacetic acid, 4-(trifluoromethyl)-, sodium salt (1:1)

Sodium 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetate

CAS: 1251924-46-5

Versatile small molecule scaffold

Formula: C₆H₃F₃NNaO₂S

Purity: Min. 95%

Molecular weight: 233.15 g/mol

Ref: 3D-BAC92446