CAS 1251924-54-5: 1-(3-Amino-1H-1,2,4-triazol-5-yl)-4-piperidinecarboxylic acid

Description: 1-(3-Amino-1H-1,2,4-triazol-5-yl)-4-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a triazole ring and a piperidine moiety. The presence of the amino group on the triazole ring contributes to its potential as a bioactive molecule, possibly influencing its interaction with biological targets. The carboxylic acid functional group enhances its solubility in polar solvents and may play a role in its reactivity and ability to form salts. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. Its molecular structure allows for various potential modifications, which can lead to derivatives with enhanced efficacy or selectivity. The compound's CAS number, 1251924-54-5, serves as a unique identifier in chemical databases, facilitating its study and application in various fields, including medicinal chemistry and agrochemicals. Overall, this compound represents a class of substances that could be valuable in drug development and other chemical applications.

Formula: C₈H₁₃N₅O₂

InChI: InChI=1S/C8H13N5O2/c9-7-10-8(12-11-7)13-3-1-5(2-4-13)6(14)15/h5H,1-4H2,(H,14,15)(H3,9,10,11,12)

InChI key: InChIKey=RBOXDPNEPJIQKC-UHFFFAOYSA-N

SMILES: O=C(O)C1CCN(C2=NN=C(N)N2)CC1

Synonyms:

• 4-Piperidinecarboxylic acid, 1-(3-amino-1H-1,2,4-triazol-5-yl)-
• 1-(3-Amino-1H-1,2,4-triazol-5-yl)-4-piperidinecarboxylic acid
• 1-(5-Amino-4H-1,2,4-triazol-3-yl)piperidine-4-carboxylic acid

1-(5-Amino-4H-1,2,4-triazol-3-yl)piperidine-4-carboxylic acid

CAS: 1251924-54-5

Versatile small molecule scaffold

• Formula: C₈H₁₃N₅O₂
• Purity: Min. 95%
• Molecular weight: 211.22 g/mol

1-(5-Amino-4h-1,2,4-triazol-3-yl)piperidine-4-carboxylic acid

CAS: 1251924-54-5

• Purity: 95%
• Molecular weight: 211.22500610351562