CymitQuimica logo

CAS 1251924-55-6

:

2-(4-Fluorophenyl)-4,5,6,7-tetrahydro-7-benzothiazolamine

Description:
2-(4-Fluorophenyl)-4,5,6,7-tetrahydro-7-benzothiazolamine is a chemical compound characterized by its unique structural features, which include a benzothiazole moiety and a tetrahydro structure. The presence of a fluorine atom on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the amine functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The compound's specific interactions with biological targets can be influenced by its stereochemistry and electronic properties, making it a subject of interest in drug discovery. Additionally, safety and handling considerations are essential, as with any chemical substance, to ensure proper laboratory practices. Overall, 2-(4-Fluorophenyl)-4,5,6,7-tetrahydro-7-benzothiazolamine represents a class of compounds that may hold promise for further research and development in therapeutic applications.
Formula:C13H13FN2S
InChI:InChI=1S/C13H13FN2S/c14-9-6-4-8(5-7-9)13-16-11-3-1-2-10(15)12(11)17-13/h4-7,10H,1-3,15H2
InChI key:InChIKey=LJZJZYQBHPXJMH-UHFFFAOYSA-N
SMILES:NC1C=2SC(=NC2CCC1)C3=CC=C(F)C=C3
Synonyms:
  • 2-(4-Fluorophenyl)-4,5,6,7-tetrahydro-7-benzothiazolamine
  • 7-Benzothiazolamine, 2-(4-fluorophenyl)-4,5,6,7-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.