
CAS 1251925-04-8
:5-Aminooctahydro-2-(trifluoromethyl)-2-pentalenol
Description:
5-Aminooctahydro-2-(trifluoromethyl)-2-pentalenol is a chemical compound characterized by its unique structural features, including an amino group and a trifluoromethyl group, which significantly influence its chemical reactivity and physical properties. The presence of the octahydro framework indicates that the compound has a saturated cyclic structure, contributing to its stability and potential applications in various fields, including pharmaceuticals and agrochemicals. The trifluoromethyl group enhances lipophilicity and can improve the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the amino group can participate in hydrogen bonding, affecting solubility and interaction with biological targets. The compound's specific properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, 5-Aminooctahydro-2-(trifluoromethyl)-2-pentalenol represents a versatile structure with potential applications in synthetic chemistry and drug development.
Formula:C9H14F3NO
InChI:InChI=1S/C9H14F3NO/c10-9(11,12)8(14)3-5-1-7(13)2-6(5)4-8/h5-7,14H,1-4,13H2
InChI key:InChIKey=OCSMNKFEZMIKBI-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1(O)CC2C(C1)CC(N)C2
Synonyms:- 2-Pentalenol, 5-aminooctahydro-2-(trifluoromethyl)-
- 5-Aminooctahydro-2-(trifluoromethyl)-2-pentalenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.