CAS 1251925-09-3

1H-1,2,4-Triazole, 1-(3-azetidinyl)-, hydrochloride (1:2)

Description:

1H-1,2,4-Triazole, 1-(3-azetidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a 3-azetidinyl substituent, indicating the presence of a four-membered cyclic amine, which contributes to its biological activity and potential pharmacological properties. The hydrochloride form suggests that the compound is a salt, enhancing its solubility in water and stability. Typically, triazoles are known for their applications in agriculture as fungicides and in pharmaceuticals for their antimicrobial and antifungal properties. The specific interactions and reactivity of this compound may be influenced by the azetidine moiety, which can affect its binding affinity to biological targets. Overall, this compound's unique structure positions it as a candidate for further research in medicinal chemistry and related fields, although detailed studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₅H₈N₄·2ClH

InChI: InChI=1S/C5H8N4.2ClH/c1-5(2-6-1)9-4-7-3-8-9;;/h3-6H,1-2H2;2*1H

InChI key: InChIKey=KUZMSAKUXKGEDZ-UHFFFAOYSA-N

SMILES: C1(CNC1)N2C=NC=N2.Cl

Synonyms:

• 1H-1,2,4-Triazole, 1-(3-azetidinyl)-, hydrochloride (1:2)

1-(Azetidin-3-yl)-1H-1,2,4-triazole dihydrochloride

CAS: 1251925-09-3

Versatile small molecule scaffold

Formula: C₅H₁₀Cl₂N₄

Purity: Min. 95%

Molecular weight: 197.06 g/mol

Ref: 3D-BAC92509