CAS 1251925-13-9

1-Methoxy-3-methyl-3-azabicyclo[4.1.0]heptane-7-carboxylic acid

Description:

1-Methoxy-3-methyl-3-azabicyclo[4.1.0]heptane-7-carboxylic acid is a bicyclic compound characterized by its unique structural framework, which includes a nitrogen atom integrated into a bicyclic system. This compound features a methoxy group and a carboxylic acid functional group, contributing to its potential reactivity and solubility in various solvents. The presence of the azabicyclic structure suggests that it may exhibit interesting pharmacological properties, possibly influencing its interaction with biological systems. The molecular configuration allows for stereochemical variations, which can affect its biological activity and binding affinity to target receptors. Additionally, the compound's molecular weight and polar functional groups may influence its physical properties, such as melting point and solubility. As with many compounds containing nitrogen and carboxylic acid groups, it may participate in hydrogen bonding, impacting its behavior in different environments. Overall, 1-Methoxy-3-methyl-3-azabicyclo[4.1.0]heptane-7-carboxylic acid represents a complex structure with potential applications in medicinal chemistry and related fields.

Formula: C₉H₁₅NO₃

InChI: InChI=1S/C9H15NO3/c1-10-4-3-6-7(8(11)12)9(6,5-10)13-2/h6-7H,3-5H2,1-2H3,(H,11,12)

InChI key: InChIKey=DFJHSTIEMBTWCL-UHFFFAOYSA-N

SMILES: O(C)C12C(C1C(O)=O)CCN(C)C2

Synonyms:

• 1-Methoxy-3-methyl-3-azabicyclo[4.1.0]heptane-7-carboxylic acid
• 3-Azabicyclo[4.1.0]heptane-7-carboxylic acid, 1-methoxy-3-methyl-