
CAS 1251925-15-1
:6-Amino-3-(phenylmethyl)-3-azabicyclo[3.1.1]heptane-6-carboxylic acid
Description:
6-Amino-3-(phenylmethyl)-3-azabicyclo[3.1.1]heptane-6-carboxylic acid is a bicyclic compound characterized by its unique bicyclo[3.1.1] structure, which consists of a seven-membered ring system. The presence of an amino group at the 6-position and a carboxylic acid functional group contributes to its potential as a bioactive molecule. The phenylmethyl substituent at the 3-position enhances its lipophilicity, which may influence its interaction with biological targets. This compound may exhibit properties typical of amino acids and could be involved in various biochemical pathways. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system or other therapeutic areas. The compound's specific stereochemistry and functional groups may also play a crucial role in its biological activity and solubility. As with many compounds in this class, further studies would be necessary to fully elucidate its pharmacological properties and potential uses.
Formula:C14H18N2O2
InChI:InChI=1S/C14H18N2O2/c15-14(13(17)18)11-6-12(14)9-16(8-11)7-10-4-2-1-3-5-10/h1-5,11-12H,6-9,15H2,(H,17,18)
InChI key:InChIKey=KTUFNVLSCJGKRT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(N)C2CC1CN(CC3=CC=CC=C3)C2
Synonyms:- 3-Azabicyclo[3.1.1]heptane-6-carboxylic acid, 6-amino-3-(phenylmethyl)-
- 6-Amino-3-(phenylmethyl)-3-azabicyclo[3.1.1]heptane-6-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.