CymitQuimica logo

CAS 1251925-18-4

:

rel-(1R,2R)-2-(1H-Pyrazol-1-yl)cyclopentanol

Description:
Rel-(1R,2R)-2-(1H-Pyrazol-1-yl)cyclopentanol is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopentanol ring and a pyrazole moiety. The compound features specific stereochemistry, indicated by the (1R,2R) configuration, which plays a crucial role in its biological activity and interactions. The presence of the pyrazole ring contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry for the development of therapeutic agents. The hydroxyl group (-OH) on the cyclopentanol ring enhances its solubility in polar solvents and may participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. Additionally, the compound's molecular structure suggests potential for various applications, including in drug design and synthesis. Its CAS number, 1251925-18-4, allows for easy identification and reference in chemical databases. Overall, the characteristics of this compound make it a subject of interest for further research in both synthetic and medicinal chemistry.
Formula:C8H12N2O
InChI:InChI=1/C8H12N2O/c11-8-4-1-3-7(8)10-6-2-5-9-10/h2,5-8,11H,1,3-4H2/t7-,8-/s2
InChI key:InChIKey=BOKRXYSLZWESBK-YZYOREDDNA-N
SMILES:O[C@H]1[C@@H](CCC1)N2C=CC=N2
Synonyms:
  • Cyclopentanol, 2-(1H-pyrazol-1-yl)-, (1R,2R)-rel-
  • rel-(1R,2R)-2-(1H-Pyrazol-1-yl)cyclopentanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.